C30H27N3O4 — CID 3739929
13-(2,3-dihydro-1,4-benzodioxin-6-yl)-10-(4-propan-2-ylphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione (PubChem CID 3739929) has the molecular formula C30H27N3O4 and a molecular weight of 493.56 g/mol. Its IUPAC name is 13-(2,3-dihydro-1,4-benzodioxin-6-yl)-10-(4-propan-2-ylphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione.
| Compound Name | 13-(2,3-dihydro-1,4-benzodioxin-6-yl)-10-(4-propan-2-ylphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
|---|---|
| PubChem CID | 3739929 |
| Molecular Formula | C30H27N3O4 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 13-(2,3-dihydro-1,4-benzodioxin-6-yl)-10-(4-propan-2-ylphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
| SMILES | CC(C)c1ccc(C2c3[nH]c4ccccc4c3CC3C(=O)N(c4ccc5c(c4)OCCO5)C(=O)N32)cc1 |
| InChI | InChI=1S/C30H27N3O4/c1-17(2)18-7-9-19(10-8-18)28-27-22(21-5-3-4-6-23(21)31-27)16-24-29(34)32(30(35)33(24)28)20-11-12-25-26(15-20)37-14-13-36-25/h3-12,15,17,24,28,31H,13-14,16H2,1-2H3 |
| InChIKey | RBRCCZAOWVKESV-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|