C27H20ClN3O4 — CID 3766889
10-(3-chlorophenyl)-13-(2,3-dihydro-1,4-benzodioxin-6-yl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione (PubChem CID 3766889) has the molecular formula C27H20ClN3O4 and a molecular weight of 485.93 g/mol. Its IUPAC name is 10-(3-chlorophenyl)-13-(2,3-dihydro-1,4-benzodioxin-6-yl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione.
| Compound Name | 10-(3-chlorophenyl)-13-(2,3-dihydro-1,4-benzodioxin-6-yl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
|---|---|
| PubChem CID | 3766889 |
| Molecular Formula | C27H20ClN3O4 |
| Molecular Weight | 485.93 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 10-(3-chlorophenyl)-13-(2,3-dihydro-1,4-benzodioxin-6-yl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
| SMILES | O=C1C2Cc3c([nH]c4ccccc34)C(c3cccc(Cl)c3)N2C(=O)N1c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C27H20ClN3O4/c28-16-5-3-4-15(12-16)25-24-19(18-6-1-2-7-20(18)29-24)14-21-26(32)30(27(33)31(21)25)17-8-9-22-23(13-17)35-11-10-34-22/h1-9,12-13,21,25,29H,10-11,14H2 |
| InChIKey | VQEDPWLEXSVTDR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.93 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|