C26H20ClN3O2 — CID 40872331
(10R,15S)-10-(3-chlorophenyl)-13-(3-methylphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione (PubChem CID 40872331) has the molecular formula C26H20ClN3O2 and a molecular weight of 441.92 g/mol. Its IUPAC name is (10R,15S)-10-(3-chlorophenyl)-13-(3-methylphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione.
| Compound Name | (10R,15S)-10-(3-chlorophenyl)-13-(3-methylphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
|---|---|
| PubChem CID | 40872331 |
| Molecular Formula | C26H20ClN3O2 |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | (10R,15S)-10-(3-chlorophenyl)-13-(3-methylphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
| SMILES | Cc1cccc(N2C(=O)[C@@H]3Cc4c([nH]c5ccccc45)[C@@H](c4cccc(Cl)c4)N3C2=O)c1 |
| InChI | InChI=1S/C26H20ClN3O2/c1-15-6-4-9-18(12-15)29-25(31)22-14-20-19-10-2-3-11-21(19)28-23(20)24(30(22)26(29)32)16-7-5-8-17(27)13-16/h2-13,22,24,28H,14H2,1H3/t22-,24+/m0/s1 |
| InChIKey | XTRARPMVPVDXHB-LADGPHEKSA-N |
| XLogP | 5.61 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|