C19H22FN3O4S2 — CID 25436725
4-[[3-(4-fluorophenyl)sulfanylpropanoylamino]carbamoyl]-N-propan-2-ylbenzenesulfonamide (PubChem CID 25436725) has the molecular formula C19H22FN3O4S2 and a molecular weight of 439.53 g/mol. Its IUPAC name is 4-[[3-(4-fluorophenyl)sulfanylpropanoylamino]carbamoyl]-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 4-[[3-(4-fluorophenyl)sulfanylpropanoylamino]carbamoyl]-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 25436725 |
| Molecular Formula | C19H22FN3O4S2 |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 4-[[3-(4-fluorophenyl)sulfanylpropanoylamino]carbamoyl]-N-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(C(=O)NNC(=O)CCSc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H22FN3O4S2/c1-13(2)23-29(26,27)17-9-3-14(4-10-17)19(25)22-21-18(24)11-12-28-16-7-5-15(20)6-8-16/h3-10,13,23H,11-12H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | WAUOQAJOWDYPCV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|