C24H25N3OS2 — CID 25487908
trans-(1R,2R)-2-(1,3-benzothiazol-2-yl)-N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]cyclohexane-1-carboxamide (PubChem CID 25487908) has the molecular formula C24H25N3OS2 and a molecular weight of 435.62 g/mol. Its IUPAC name is trans-(1R,2R)-2-(1,3-benzothiazol-2-yl)-N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]cyclohexane-1-carboxamide.
| Compound Name | trans-(1R,2R)-2-(1,3-benzothiazol-2-yl)-N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 25487908 |
| Molecular Formula | C24H25N3OS2 |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | trans-(1R,2R)-2-(1,3-benzothiazol-2-yl)-N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]cyclohexane-1-carboxamide |
| SMILES | N#Cc1ccccc1CSCCNC(=O)[C@@H]1CCCC[C@H]1c1nc2ccccc2s1 |
| InChI | InChI=1S/C24H25N3OS2/c25-15-17-7-1-2-8-18(17)16-29-14-13-26-23(28)19-9-3-4-10-20(19)24-27-21-11-5-6-12-22(21)30-24/h1-2,5-8,11-12,19-20H,3-4,9-10,13-14,16H2,(H,26,28)/t19-,20-/m1/s1 |
| InChIKey | RGKVPMLJMVKWKK-WOJBJXKFSA-N |
| XLogP | 5.49 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|