C14H13F2N5O2 — CID 25497888
1-[(2,4-difluorophenyl)methyl]-1-methyl-3-(pyrazine-2-carbonylamino)urea (PubChem CID 25497888) has the molecular formula C14H13F2N5O2 and a molecular weight of 321.29 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]-1-methyl-3-(pyrazine-2-carbonylamino)urea.
| Compound Name | 1-[(2,4-difluorophenyl)methyl]-1-methyl-3-(pyrazine-2-carbonylamino)urea |
|---|---|
| PubChem CID | 25497888 |
| Molecular Formula | C14H13F2N5O2 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl]-1-methyl-3-(pyrazine-2-carbonylamino)urea |
| SMILES | CN(Cc1ccc(F)cc1F)C(=O)NNC(=O)c1cnccn1 |
| InChI | InChI=1S/C14H13F2N5O2/c1-21(8-9-2-3-10(15)6-11(9)16)14(23)20-19-13(22)12-7-17-4-5-18-12/h2-7H,8H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | GPXCAVMXAYOQCI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|