C16H14ClN3O5S — CID 25498819
5-chloro-N-[3-(cyclopropylsulfamoyl)phenyl]-2-nitrobenzamide (PubChem CID 25498819) has the molecular formula C16H14ClN3O5S and a molecular weight of 395.82 g/mol. Its IUPAC name is 5-chloro-N-[3-(cyclopropylsulfamoyl)phenyl]-2-nitrobenzamide.
| Compound Name | 5-chloro-N-[3-(cyclopropylsulfamoyl)phenyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 25498819 |
| Molecular Formula | C16H14ClN3O5S |
| Molecular Weight | 395.82 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | 5-chloro-N-[3-(cyclopropylsulfamoyl)phenyl]-2-nitrobenzamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)NC2CC2)c1)c1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14ClN3O5S/c17-10-4-7-15(20(22)23)14(8-10)16(21)18-12-2-1-3-13(9-12)26(24,25)19-11-5-6-11/h1-4,7-9,11,19H,5-6H2,(H,18,21) |
| InChIKey | VCBLBYKNWDKBDW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.82 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|