C18H17N3O5S — CID 24582350
(E)-N-[3-(cyclopropylsulfamoyl)phenyl]-3-(2-nitrophenyl)prop-2-enamide (PubChem CID 24582350) has the molecular formula C18H17N3O5S and a molecular weight of 387.42 g/mol. Its IUPAC name is (E)-N-[3-(cyclopropylsulfamoyl)phenyl]-3-(2-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[3-(cyclopropylsulfamoyl)phenyl]-3-(2-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 24582350 |
| Molecular Formula | C18H17N3O5S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | (E)-N-[3-(cyclopropylsulfamoyl)phenyl]-3-(2-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1[N+](=O)[O-])Nc1cccc(S(=O)(=O)NC2CC2)c1 |
| InChI | InChI=1S/C18H17N3O5S/c22-18(11-8-13-4-1-2-7-17(13)21(23)24)19-15-5-3-6-16(12-15)27(25,26)20-14-9-10-14/h1-8,11-12,14,20H,9-10H2,(H,19,22)/b11-8+ |
| InChIKey | PDVYJJUOARDZTR-DHZHZOJOSA-N |
| XLogP | 2.69 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|