C24H22ClNO5 — CID 2550901
(6-chloro-7-methyl-2-oxochromen-4-yl)methyl (3R)-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxylate (PubChem CID 2550901) has the molecular formula C24H22ClNO5 and a molecular weight of 439.90 g/mol. Its IUPAC name is (6-chloro-7-methyl-2-oxochromen-4-yl)methyl (3R)-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxylate.
| Compound Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl (3R)-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 2550901 |
| Molecular Formula | C24H22ClNO5 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl (3R)-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxylate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)[C@@H]3CC(=O)N(CCc4ccccc4)C3)c2cc1Cl |
| InChI | InChI=1S/C24H22ClNO5/c1-15-9-21-19(12-20(15)25)18(11-23(28)31-21)14-30-24(29)17-10-22(27)26(13-17)8-7-16-5-3-2-4-6-16/h2-6,9,11-12,17H,7-8,10,13-14H2,1H3/t17-/m1/s1 |
| InChIKey | VQNOSNVSJRBANU-QGZVFWFLSA-N |
| XLogP | 3.89 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|