C21H9Cl2F3NO2S- — CID 2554599
6-chloro-2-[5-[2-chloro-5-(trifluoromethyl)phenyl]thiophen-2-yl]quinoline-4-carboxylate (PubChem CID 2554599) has the molecular formula C21H9Cl2F3NO2S- and a molecular weight of 467.28 g/mol. Its IUPAC name is 6-chloro-2-[5-[2-chloro-5-(trifluoromethyl)phenyl]thiophen-2-yl]quinoline-4-carboxylate.
| Compound Name | 6-chloro-2-[5-[2-chloro-5-(trifluoromethyl)phenyl]thiophen-2-yl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2554599 |
| Molecular Formula | C21H9Cl2F3NO2S- |
| Molecular Weight | 467.28 g/mol |
| Exact Mass | 465.97 |
| IUPAC Name | 6-chloro-2-[5-[2-chloro-5-(trifluoromethyl)phenyl]thiophen-2-yl]quinoline-4-carboxylate |
| SMILES | O=C([O-])c1cc(-c2ccc(-c3cc(C(F)(F)F)ccc3Cl)s2)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C21H10Cl2F3NO2S/c22-11-2-4-16-12(8-11)13(20(28)29)9-17(27-16)19-6-5-18(30-19)14-7-10(21(24,25)26)1-3-15(14)23/h1-9H,(H,28,29)/p-1 |
| InChIKey | APOIOHNTSFXPSH-UHFFFAOYSA-M |
| XLogP | 6.32 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.28 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |