C22H21NO4S — CID 2555971
3-(3,3-diphenylpropylsulfamoyl)benzoic acid (PubChem CID 2555971) has the molecular formula C22H21NO4S and a molecular weight of 395.48 g/mol. Its IUPAC name is 3-(3,3-diphenylpropylsulfamoyl)benzoic acid.
| Compound Name | 3-(3,3-diphenylpropylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 2555971 |
| Molecular Formula | C22H21NO4S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 3-(3,3-diphenylpropylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1cccc(S(=O)(=O)NCCC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C22H21NO4S/c24-22(25)19-12-7-13-20(16-19)28(26,27)23-15-14-21(17-8-3-1-4-9-17)18-10-5-2-6-11-18/h1-13,16,21,23H,14-15H2,(H,24,25) |
| InChIKey | HMMTYZGNGKIIOB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |