C25H22N4O4S — CID 2564088
2-[[2-[3-(2-hydroxyethyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]amino]-N-phenylbenzamide (PubChem CID 2564088) has the molecular formula C25H22N4O4S and a molecular weight of 474.54 g/mol. Its IUPAC name is 2-[[2-[3-(2-hydroxyethyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]amino]-N-phenylbenzamide.
| Compound Name | 2-[[2-[3-(2-hydroxyethyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]amino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 2564088 |
| Molecular Formula | C25H22N4O4S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 2-[[2-[3-(2-hydroxyethyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]amino]-N-phenylbenzamide |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1CCO)Nc1ccccc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C25H22N4O4S/c30-15-14-29-24(33)19-11-5-7-13-21(19)28-25(29)34-16-22(31)27-20-12-6-4-10-18(20)23(32)26-17-8-2-1-3-9-17/h1-13,30H,14-16H2,(H,26,32)(H,27,31) |
| InChIKey | NIHVAXXEPUMOPM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |