C21H16N4O2S — CID 2587056
1-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]benzo[f]chromen-3-one (PubChem CID 2587056) has the molecular formula C21H16N4O2S and a molecular weight of 388.45 g/mol. Its IUPAC name is 1-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]benzo[f]chromen-3-one.
| Compound Name | 1-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]benzo[f]chromen-3-one |
|---|---|
| PubChem CID | 2587056 |
| Molecular Formula | C21H16N4O2S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 1-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]benzo[f]chromen-3-one |
| SMILES | Cc1cc(C)n2nc(SCc3cc(=O)oc4ccc5ccccc5c34)nc2n1 |
| InChI | InChI=1S/C21H16N4O2S/c1-12-9-13(2)25-20(22-12)23-21(24-25)28-11-15-10-18(26)27-17-8-7-14-5-3-4-6-16(14)19(15)17/h3-10H,11H2,1-2H3 |
| InChIKey | SLSZAFOYSVDWSD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 73.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|