C15H13N7OS — CID 2587357
3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-1,2,3-benzotriazin-4-one (PubChem CID 2587357) has the molecular formula C15H13N7OS and a molecular weight of 339.38 g/mol. Its IUPAC name is 3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-1,2,3-benzotriazin-4-one.
| Compound Name | 3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 2587357 |
| Molecular Formula | C15H13N7OS |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-1,2,3-benzotriazin-4-one |
| SMILES | Cc1cc(C)n2nc(SCn3nnc4ccccc4c3=O)nc2n1 |
| InChI | InChI=1S/C15H13N7OS/c1-9-7-10(2)22-14(16-9)17-15(19-22)24-8-21-13(23)11-5-3-4-6-12(11)18-20-21/h3-7H,8H2,1-2H3 |
| InChIKey | SPMGUYCGRWBRLE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 90.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |