C20H16O7 — CID 2590659
[2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-oxochromene-2-carboxylate (PubChem CID 2590659) has the molecular formula C20H16O7 and a molecular weight of 368.34 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-oxochromene-2-carboxylate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 2590659 |
| Molecular Formula | C20H16O7 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-oxochromene-2-carboxylate |
| SMILES | COc1ccc(C(=O)COC(=O)c2cc(=O)c3ccccc3o2)cc1OC |
| InChI | InChI=1S/C20H16O7/c1-24-17-8-7-12(9-18(17)25-2)15(22)11-26-20(23)19-10-14(21)13-5-3-4-6-16(13)27-19/h3-10H,11H2,1-2H3 |
| InChIKey | CIYSMAHAXAAMGH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |