C19H21N3O4S2 — CID 26039384
10-[[[(3R)-1,1-dioxothiolan-3-yl]-(furan-2-ylmethyl)amino]methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one (PubChem CID 26039384) has the molecular formula C19H21N3O4S2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 10-[[[(3R)-1,1-dioxothiolan-3-yl]-(furan-2-ylmethyl)amino]methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one.
| Compound Name | 10-[[[(3R)-1,1-dioxothiolan-3-yl]-(furan-2-ylmethyl)amino]methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
|---|---|
| PubChem CID | 26039384 |
| Molecular Formula | C19H21N3O4S2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 10-[[[(3R)-1,1-dioxothiolan-3-yl]-(furan-2-ylmethyl)amino]methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
| SMILES | O=c1[nH]c(CN(Cc2ccco2)[C@@H]2CCS(=O)(=O)C2)nc2sc3c(c12)CCC3 |
| InChI | InChI=1S/C19H21N3O4S2/c23-18-17-14-4-1-5-15(14)27-19(17)21-16(20-18)10-22(9-13-3-2-7-26-13)12-6-8-28(24,25)11-12/h2-3,7,12H,1,4-6,8-11H2,(H,20,21,23)/t12-/m1/s1 |
| InChIKey | VDTUGLOSGZXDOX-GFCCVEGCSA-N |
| XLogP | 2.26 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |