C16H12Cl2N4O3 — CID 26062148
N'-(2,5-dichlorobenzoyl)-3,6-dimethyl-[1,2]oxazolo[5,4-b]pyridine-4-carbohydrazide (PubChem CID 26062148) has the molecular formula C16H12Cl2N4O3 and a molecular weight of 379.20 g/mol. Its IUPAC name is N'-(2,5-dichlorobenzoyl)-3,6-dimethyl-[1,2]oxazolo[5,4-b]pyridine-4-carbohydrazide.
| Compound Name | N'-(2,5-dichlorobenzoyl)-3,6-dimethyl-[1,2]oxazolo[5,4-b]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 26062148 |
| Molecular Formula | C16H12Cl2N4O3 |
| Molecular Weight | 379.20 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | N'-(2,5-dichlorobenzoyl)-3,6-dimethyl-[1,2]oxazolo[5,4-b]pyridine-4-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2cc(Cl)ccc2Cl)c2c(C)noc2n1 |
| InChI | InChI=1S/C16H12Cl2N4O3/c1-7-5-11(13-8(2)22-25-16(13)19-7)15(24)21-20-14(23)10-6-9(17)3-4-12(10)18/h3-6H,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | ADFJMROSPYGHPW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.20 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|