C20H30N2O3 — CID 2613832
[2-[[(1R,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 2-(butylamino)benzoate (PubChem CID 2613832) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is [2-[[(1R,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 2-(butylamino)benzoate.
| Compound Name | [2-[[(1R,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 2-(butylamino)benzoate |
|---|---|
| PubChem CID | 2613832 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | [2-[[(1R,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 2-(butylamino)benzoate |
| SMILES | CCCCNc1ccccc1C(=O)OCC(=O)N[C@@H]1CCCC[C@H]1C |
| InChI | InChI=1S/C20H30N2O3/c1-3-4-13-21-18-12-8-6-10-16(18)20(24)25-14-19(23)22-17-11-7-5-9-15(17)2/h6,8,10,12,15,17,21H,3-5,7,9,11,13-14H2,1-2H3,(H,22,23)/t15-,17-/m1/s1 |
| InChIKey | ZHMUPVDNUSLFEA-NVXWUHKLSA-N |
| XLogP | 3.75 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|