C16H15N3O4S — CID 2614117
N-(3,4-dimethoxyphenyl)-2-thieno[2,3-d]pyrimidin-4-yloxyacetamide (PubChem CID 2614117) has the molecular formula C16H15N3O4S and a molecular weight of 345.38 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-thieno[2,3-d]pyrimidin-4-yloxyacetamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-thieno[2,3-d]pyrimidin-4-yloxyacetamide |
|---|---|
| PubChem CID | 2614117 |
| Molecular Formula | C16H15N3O4S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-thieno[2,3-d]pyrimidin-4-yloxyacetamide |
| SMILES | COc1ccc(NC(=O)COc2ncnc3sccc23)cc1OC |
| InChI | InChI=1S/C16H15N3O4S/c1-21-12-4-3-10(7-13(12)22-2)19-14(20)8-23-15-11-5-6-24-16(11)18-9-17-15/h3-7,9H,8H2,1-2H3,(H,19,20) |
| InChIKey | JMEADMCATKLSED-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |