C22H28N2O2 — CID 26161397
N-[3-(hexanoylamino)phenyl]-4-propan-2-ylbenzamide (PubChem CID 26161397) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is N-[3-(hexanoylamino)phenyl]-4-propan-2-ylbenzamide.
| Compound Name | N-[3-(hexanoylamino)phenyl]-4-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 26161397 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | N-[3-(hexanoylamino)phenyl]-4-propan-2-ylbenzamide |
| SMILES | CCCCCC(=O)Nc1cccc(NC(=O)c2ccc(C(C)C)cc2)c1 |
| InChI | InChI=1S/C22H28N2O2/c1-4-5-6-10-21(25)23-19-8-7-9-20(15-19)24-22(26)18-13-11-17(12-14-18)16(2)3/h7-9,11-16H,4-6,10H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | UYHNUHOVYFZYTJ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|