C28H31BrN2O3 — CID 26162981
N-[3-[benzyl(methyl)carbamoyl]phenyl]-3-bromo-4-hexoxybenzamide (PubChem CID 26162981) has the molecular formula C28H31BrN2O3 and a molecular weight of 523.47 g/mol. Its IUPAC name is N-[3-[benzyl(methyl)carbamoyl]phenyl]-3-bromo-4-hexoxybenzamide.
| Compound Name | N-[3-[benzyl(methyl)carbamoyl]phenyl]-3-bromo-4-hexoxybenzamide |
|---|---|
| PubChem CID | 26162981 |
| Molecular Formula | C28H31BrN2O3 |
| Molecular Weight | 523.47 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | N-[3-[benzyl(methyl)carbamoyl]phenyl]-3-bromo-4-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(C(=O)Nc2cccc(C(=O)N(C)Cc3ccccc3)c2)cc1Br |
| InChI | InChI=1S/C28H31BrN2O3/c1-3-4-5-9-17-34-26-16-15-22(19-25(26)29)27(32)30-24-14-10-13-23(18-24)28(33)31(2)20-21-11-7-6-8-12-21/h6-8,10-16,18-19H,3-5,9,17,20H2,1-2H3,(H,30,32) |
| InChIKey | ZDWPHSZIQBTAMN-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.47 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|