C19H15BrN2OS — CID 26176564
(E)-3-(3-bromophenyl)-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylprop-2-enamide (PubChem CID 26176564) has the molecular formula C19H15BrN2OS and a molecular weight of 399.31 g/mol. Its IUPAC name is (E)-3-(3-bromophenyl)-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylprop-2-enamide.
| Compound Name | (E)-3-(3-bromophenyl)-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 26176564 |
| Molecular Formula | C19H15BrN2OS |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | (E)-3-(3-bromophenyl)-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylprop-2-enamide |
| SMILES | Cc1csc(N(C(=O)/C=C/c2cccc(Br)c2)c2ccccc2)n1 |
| InChI | InChI=1S/C19H15BrN2OS/c1-14-13-24-19(21-14)22(17-8-3-2-4-9-17)18(23)11-10-15-6-5-7-16(20)12-15/h2-13H,1H3/b11-10+ |
| InChIKey | MQYCDIAMTCKPMV-ZHACJKMWSA-N |
| XLogP | 5.59 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|