C21H24ClN3O3 — CID 26198586
N-(3-chloro-2,6-diethylphenyl)-3-nitro-4-pyrrolidin-1-ylbenzamide (PubChem CID 26198586) has the molecular formula C21H24ClN3O3 and a molecular weight of 401.89 g/mol. Its IUPAC name is N-(3-chloro-2,6-diethylphenyl)-3-nitro-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-(3-chloro-2,6-diethylphenyl)-3-nitro-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 26198586 |
| Molecular Formula | C21H24ClN3O3 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | N-(3-chloro-2,6-diethylphenyl)-3-nitro-4-pyrrolidin-1-ylbenzamide |
| SMILES | CCc1ccc(Cl)c(CC)c1NC(=O)c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H24ClN3O3/c1-3-14-7-9-17(22)16(4-2)20(14)23-21(26)15-8-10-18(19(13-15)25(27)28)24-11-5-6-12-24/h7-10,13H,3-6,11-12H2,1-2H3,(H,23,26) |
| InChIKey | WPOQHGCDZJIDLZ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|