C22H24N4O3S2 — CID 26224528
N-(pyridin-2-ylmethyl)-3-pyrrolidin-1-ylsulfonyl-5-(thiophen-2-ylmethylamino)benzamide (PubChem CID 26224528) has the molecular formula C22H24N4O3S2 and a molecular weight of 456.59 g/mol. Its IUPAC name is N-(pyridin-2-ylmethyl)-3-pyrrolidin-1-ylsulfonyl-5-(thiophen-2-ylmethylamino)benzamide.
| Compound Name | N-(pyridin-2-ylmethyl)-3-pyrrolidin-1-ylsulfonyl-5-(thiophen-2-ylmethylamino)benzamide |
|---|---|
| PubChem CID | 26224528 |
| Molecular Formula | C22H24N4O3S2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | N-(pyridin-2-ylmethyl)-3-pyrrolidin-1-ylsulfonyl-5-(thiophen-2-ylmethylamino)benzamide |
| SMILES | O=C(NCc1ccccn1)c1cc(NCc2cccs2)cc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C22H24N4O3S2/c27-22(25-15-18-6-1-2-8-23-18)17-12-19(24-16-20-7-5-11-30-20)14-21(13-17)31(28,29)26-9-3-4-10-26/h1-2,5-8,11-14,24H,3-4,9-10,15-16H2,(H,25,27) |
| InChIKey | SXQUVYZFHNDFIM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |