C21H21N5O3S2 — CID 26227458
3-(dimethylsulfamoyl)-N-(1H-indazol-6-yl)-5-(thiophen-3-ylmethylamino)benzamide (PubChem CID 26227458) has the molecular formula C21H21N5O3S2 and a molecular weight of 455.57 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-N-(1H-indazol-6-yl)-5-(thiophen-3-ylmethylamino)benzamide.
| Compound Name | 3-(dimethylsulfamoyl)-N-(1H-indazol-6-yl)-5-(thiophen-3-ylmethylamino)benzamide |
|---|---|
| PubChem CID | 26227458 |
| Molecular Formula | C21H21N5O3S2 |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 3-(dimethylsulfamoyl)-N-(1H-indazol-6-yl)-5-(thiophen-3-ylmethylamino)benzamide |
| SMILES | CN(C)S(=O)(=O)c1cc(NCc2ccsc2)cc(C(=O)Nc2ccc3cn[nH]c3c2)c1 |
| InChI | InChI=1S/C21H21N5O3S2/c1-26(2)31(28,29)19-8-16(7-18(9-19)22-11-14-5-6-30-13-14)21(27)24-17-4-3-15-12-23-25-20(15)10-17/h3-10,12-13,22H,11H2,1-2H3,(H,23,25)(H,24,27) |
| InChIKey | CSKZNOHRVUKCBT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |