C18H24N4O4S2 — CID 26227326
N-(2-acetamidoethyl)-3-(dimethylsulfamoyl)-5-(thiophen-3-ylmethylamino)benzamide (PubChem CID 26227326) has the molecular formula C18H24N4O4S2 and a molecular weight of 424.55 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-3-(dimethylsulfamoyl)-5-(thiophen-3-ylmethylamino)benzamide.
| Compound Name | N-(2-acetamidoethyl)-3-(dimethylsulfamoyl)-5-(thiophen-3-ylmethylamino)benzamide |
|---|---|
| PubChem CID | 26227326 |
| Molecular Formula | C18H24N4O4S2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | N-(2-acetamidoethyl)-3-(dimethylsulfamoyl)-5-(thiophen-3-ylmethylamino)benzamide |
| SMILES | CC(=O)NCCNC(=O)c1cc(NCc2ccsc2)cc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C18H24N4O4S2/c1-13(23)19-5-6-20-18(24)15-8-16(21-11-14-4-7-27-12-14)10-17(9-15)28(25,26)22(2)3/h4,7-10,12,21H,5-6,11H2,1-3H3,(H,19,23)(H,20,24) |
| InChIKey | ARBNRFKJXWMBNB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|