C17H28N4O4S2 — CID 45165144
N-(2-acetamidoethyl)-3-(dimethylsulfamoyl)-5-(1-methylsulfanylpropan-2-ylamino)benzamide (PubChem CID 45165144) has the molecular formula C17H28N4O4S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-3-(dimethylsulfamoyl)-5-(1-methylsulfanylpropan-2-ylamino)benzamide.
| Compound Name | N-(2-acetamidoethyl)-3-(dimethylsulfamoyl)-5-(1-methylsulfanylpropan-2-ylamino)benzamide |
|---|---|
| PubChem CID | 45165144 |
| Molecular Formula | C17H28N4O4S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | N-(2-acetamidoethyl)-3-(dimethylsulfamoyl)-5-(1-methylsulfanylpropan-2-ylamino)benzamide |
| SMILES | CSCC(C)Nc1cc(C(=O)NCCNC(C)=O)cc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C17H28N4O4S2/c1-12(11-26-5)20-15-8-14(17(23)19-7-6-18-13(2)22)9-16(10-15)27(24,25)21(3)4/h8-10,12,20H,6-7,11H2,1-5H3,(H,18,22)(H,19,23) |
| InChIKey | MURABSALMKREHW-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|