C24H34N4O4S — CID 26223660
N-(2-acetamidoethyl)-3-(dimethylsulfamoyl)-5-[[4-(2-methylpropyl)phenyl]methylamino]benzamide (PubChem CID 26223660) has the molecular formula C24H34N4O4S and a molecular weight of 474.63 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-3-(dimethylsulfamoyl)-5-[[4-(2-methylpropyl)phenyl]methylamino]benzamide.
| Compound Name | N-(2-acetamidoethyl)-3-(dimethylsulfamoyl)-5-[[4-(2-methylpropyl)phenyl]methylamino]benzamide |
|---|---|
| PubChem CID | 26223660 |
| Molecular Formula | C24H34N4O4S |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | N-(2-acetamidoethyl)-3-(dimethylsulfamoyl)-5-[[4-(2-methylpropyl)phenyl]methylamino]benzamide |
| SMILES | CC(=O)NCCNC(=O)c1cc(NCc2ccc(CC(C)C)cc2)cc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C24H34N4O4S/c1-17(2)12-19-6-8-20(9-7-19)16-27-22-13-21(24(30)26-11-10-25-18(3)29)14-23(15-22)33(31,32)28(4)5/h6-9,13-15,17,27H,10-12,16H2,1-5H3,(H,25,29)(H,26,30) |
| InChIKey | IYSSFUBFGWXHIK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|