C16H25N3O4S2 — CID 72885370
3-[methyl-[1-(methylamino)-1-oxopropan-2-yl]sulfamoyl]-N-(3-methylsulfanylpropyl)benzamide (PubChem CID 72885370) has the molecular formula C16H25N3O4S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 3-[methyl-[1-(methylamino)-1-oxopropan-2-yl]sulfamoyl]-N-(3-methylsulfanylpropyl)benzamide.
| Compound Name | 3-[methyl-[1-(methylamino)-1-oxopropan-2-yl]sulfamoyl]-N-(3-methylsulfanylpropyl)benzamide |
|---|---|
| PubChem CID | 72885370 |
| Molecular Formula | C16H25N3O4S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 3-[methyl-[1-(methylamino)-1-oxopropan-2-yl]sulfamoyl]-N-(3-methylsulfanylpropyl)benzamide |
| SMILES | CNC(=O)C(C)N(C)S(=O)(=O)c1cccc(C(=O)NCCCSC)c1 |
| InChI | InChI=1S/C16H25N3O4S2/c1-12(15(20)17-2)19(3)25(22,23)14-8-5-7-13(11-14)16(21)18-9-6-10-24-4/h5,7-8,11-12H,6,9-10H2,1-4H3,(H,17,20)(H,18,21) |
| InChIKey | RQLLKPNXSNKGOZ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|