C25H29N5O3S — CID 26233143
3-[[(1R)-cyclohex-3-en-1-yl]methylamino]-N-(2-imidazol-1-ylethyl)-5-(phenylsulfamoyl)benzamide (PubChem CID 26233143) has the molecular formula C25H29N5O3S and a molecular weight of 479.61 g/mol. Its IUPAC name is 3-[[(1R)-cyclohex-3-en-1-yl]methylamino]-N-(2-imidazol-1-ylethyl)-5-(phenylsulfamoyl)benzamide.
| Compound Name | 3-[[(1R)-cyclohex-3-en-1-yl]methylamino]-N-(2-imidazol-1-ylethyl)-5-(phenylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 26233143 |
| Molecular Formula | C25H29N5O3S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 3-[[(1R)-cyclohex-3-en-1-yl]methylamino]-N-(2-imidazol-1-ylethyl)-5-(phenylsulfamoyl)benzamide |
| SMILES | O=C(NCCn1ccnc1)c1cc(NC[C@H]2CC=CCC2)cc(S(=O)(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C25H29N5O3S/c31-25(27-12-14-30-13-11-26-19-30)21-15-23(28-18-20-7-3-1-4-8-20)17-24(16-21)34(32,33)29-22-9-5-2-6-10-22/h1-3,5-6,9-11,13,15-17,19-20,28-29H,4,7-8,12,14,18H2,(H,27,31)/t20-/m0/s1 |
| InChIKey | HBEMOLIYYPFAKX-FQEVSTJZSA-N |
| XLogP | 3.88 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|