C26H33NO4S — CID 26320462
(E)-N-cyclopentyl-N-[[3-methoxy-4-[[(2S)-oxan-2-yl]methoxy]phenyl]methyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 26320462) has the molecular formula C26H33NO4S and a molecular weight of 455.62 g/mol. Its IUPAC name is (E)-N-cyclopentyl-N-[[3-methoxy-4-[[(2S)-oxan-2-yl]methoxy]phenyl]methyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-cyclopentyl-N-[[3-methoxy-4-[[(2S)-oxan-2-yl]methoxy]phenyl]methyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 26320462 |
| Molecular Formula | C26H33NO4S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | (E)-N-cyclopentyl-N-[[3-methoxy-4-[[(2S)-oxan-2-yl]methoxy]phenyl]methyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | COc1cc(CN(C(=O)/C=C/c2cccs2)C2CCCC2)ccc1OC[C@@H]1CCCCO1 |
| InChI | InChI=1S/C26H33NO4S/c1-29-25-17-20(11-13-24(25)31-19-22-9-4-5-15-30-22)18-27(21-7-2-3-8-21)26(28)14-12-23-10-6-16-32-23/h6,10-14,16-17,21-22H,2-5,7-9,15,18-19H2,1H3/b14-12+/t22-/m0/s1 |
| InChIKey | SGCLDUBYWCZHTM-VKXNWWILSA-N |
| XLogP | 5.69 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|