C24H31NO4S — CID 45204859
N-cyclopentyl-N-[[3-methoxy-4-(oxan-2-ylmethoxy)phenyl]methyl]thiophene-2-carboxamide (PubChem CID 45204859) has the molecular formula C24H31NO4S and a molecular weight of 429.58 g/mol. Its IUPAC name is N-cyclopentyl-N-[[3-methoxy-4-(oxan-2-ylmethoxy)phenyl]methyl]thiophene-2-carboxamide.
| Compound Name | N-cyclopentyl-N-[[3-methoxy-4-(oxan-2-ylmethoxy)phenyl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 45204859 |
| Molecular Formula | C24H31NO4S |
| Molecular Weight | 429.58 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | N-cyclopentyl-N-[[3-methoxy-4-(oxan-2-ylmethoxy)phenyl]methyl]thiophene-2-carboxamide |
| SMILES | COc1cc(CN(C(=O)c2cccs2)C2CCCC2)ccc1OCC1CCCCO1 |
| InChI | InChI=1S/C24H31NO4S/c1-27-22-15-18(11-12-21(22)29-17-20-9-4-5-13-28-20)16-25(19-7-2-3-8-19)24(26)23-10-6-14-30-23/h6,10-12,14-15,19-20H,2-5,7-9,13,16-17H2,1H3 |
| InChIKey | VQDOSBNRGFLJEK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.58 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |