C26H22N6O3 — CID 26326986
N-[(3,5-dimethoxyphenyl)methyl]-3-quinolin-8-yl-5-(tetrazol-1-yl)benzamide (PubChem CID 26326986) has the molecular formula C26H22N6O3 and a molecular weight of 466.50 g/mol. Its IUPAC name is N-[(3,5-dimethoxyphenyl)methyl]-3-quinolin-8-yl-5-(tetrazol-1-yl)benzamide.
| Compound Name | N-[(3,5-dimethoxyphenyl)methyl]-3-quinolin-8-yl-5-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 26326986 |
| Molecular Formula | C26H22N6O3 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | N-[(3,5-dimethoxyphenyl)methyl]-3-quinolin-8-yl-5-(tetrazol-1-yl)benzamide |
| SMILES | COc1cc(CNC(=O)c2cc(-c3cccc4cccnc34)cc(-n3cnnn3)c2)cc(OC)c1 |
| InChI | InChI=1S/C26H22N6O3/c1-34-22-9-17(10-23(14-22)35-2)15-28-26(33)20-11-19(12-21(13-20)32-16-29-30-31-32)24-7-3-5-18-6-4-8-27-25(18)24/h3-14,16H,15H2,1-2H3,(H,28,33) |
| InChIKey | HMWOTKIRSVWBAI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |