C18H22F3NO3 — CID 26330728
oxan-4-yl-[(2R)-2-[[3-(trifluoromethyl)phenyl]methyl]morpholin-4-yl]methanone (PubChem CID 26330728) has the molecular formula C18H22F3NO3 and a molecular weight of 357.37 g/mol. Its IUPAC name is oxan-4-yl-[(2R)-2-[[3-(trifluoromethyl)phenyl]methyl]morpholin-4-yl]methanone.
| Compound Name | oxan-4-yl-[(2R)-2-[[3-(trifluoromethyl)phenyl]methyl]morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 26330728 |
| Molecular Formula | C18H22F3NO3 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | oxan-4-yl-[(2R)-2-[[3-(trifluoromethyl)phenyl]methyl]morpholin-4-yl]methanone |
| SMILES | O=C(C1CCOCC1)N1CCO[C@H](Cc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C18H22F3NO3/c19-18(20,21)15-3-1-2-13(10-15)11-16-12-22(6-9-25-16)17(23)14-4-7-24-8-5-14/h1-3,10,14,16H,4-9,11-12H2/t16-/m1/s1 |
| InChIKey | WQCSDLPXUKZUTK-MRXNPFEDSA-N |
| XLogP | 2.90 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |