C31H36N4O2 — CID 26338678
(5S)-5-benzyl-3-(pyridin-3-ylmethyl)-5-[1-[(2,4,5-trimethylphenyl)methyl]piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 26338678) has the molecular formula C31H36N4O2 and a molecular weight of 496.66 g/mol. Its IUPAC name is (5S)-5-benzyl-3-(pyridin-3-ylmethyl)-5-[1-[(2,4,5-trimethylphenyl)methyl]piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-benzyl-3-(pyridin-3-ylmethyl)-5-[1-[(2,4,5-trimethylphenyl)methyl]piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 26338678 |
| Molecular Formula | C31H36N4O2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | (5S)-5-benzyl-3-(pyridin-3-ylmethyl)-5-[1-[(2,4,5-trimethylphenyl)methyl]piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | Cc1cc(C)c(CN2CCC([C@]3(Cc4ccccc4)NC(=O)N(Cc4cccnc4)C3=O)CC2)cc1C |
| InChI | InChI=1S/C31H36N4O2/c1-22-16-24(3)27(17-23(22)2)21-34-14-11-28(12-15-34)31(18-25-8-5-4-6-9-25)29(36)35(30(37)33-31)20-26-10-7-13-32-19-26/h4-10,13,16-17,19,28H,11-12,14-15,18,20-21H2,1-3H3,(H,33,37)/t31-/m0/s1 |
| InChIKey | LCJDSLCKRUCDBL-HKBQPEDESA-N |
| XLogP | 4.95 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|