C24H37N3O2 — CID 26358697
N-[2-(cyclohexen-1-yl)ethyl]-2-ethyl-6-methyl-4-oxo-1-(2-piperidin-1-ylethyl)pyridine-3-carboxamide (PubChem CID 26358697) has the molecular formula C24H37N3O2 and a molecular weight of 399.58 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-ethyl-6-methyl-4-oxo-1-(2-piperidin-1-ylethyl)pyridine-3-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-ethyl-6-methyl-4-oxo-1-(2-piperidin-1-ylethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 26358697 |
| Molecular Formula | C24H37N3O2 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.29 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-ethyl-6-methyl-4-oxo-1-(2-piperidin-1-ylethyl)pyridine-3-carboxamide |
| SMILES | CCc1c(C(=O)NCCC2=CCCCC2)c(=O)cc(C)n1CCN1CCCCC1 |
| InChI | InChI=1S/C24H37N3O2/c1-3-21-23(24(29)25-13-12-20-10-6-4-7-11-20)22(28)18-19(2)27(21)17-16-26-14-8-5-9-15-26/h10,18H,3-9,11-17H2,1-2H3,(H,25,29) |
| InChIKey | QPSAHEAMPFGTJK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|