C25H25N3O2 — CID 26359187
1-(2,2-diphenylacetyl)-4-(pyridin-4-ylmethyl)-1,4-diazepan-5-one (PubChem CID 26359187) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is 1-(2,2-diphenylacetyl)-4-(pyridin-4-ylmethyl)-1,4-diazepan-5-one.
| Compound Name | 1-(2,2-diphenylacetyl)-4-(pyridin-4-ylmethyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 26359187 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 1-(2,2-diphenylacetyl)-4-(pyridin-4-ylmethyl)-1,4-diazepan-5-one |
| SMILES | O=C1CCN(C(=O)C(c2ccccc2)c2ccccc2)CCN1Cc1ccncc1 |
| InChI | InChI=1S/C25H25N3O2/c29-23-13-16-27(17-18-28(23)19-20-11-14-26-15-12-20)25(30)24(21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1-12,14-15,24H,13,16-19H2 |
| InChIKey | SCXWXGLXXWMXBU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |