C25H26N2O5 — CID 26388023
6,7-dimethyl-4-[[(2R)-2-(morpholine-4-carbonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]methyl]chromen-2-one (PubChem CID 26388023) has the molecular formula C25H26N2O5 and a molecular weight of 434.49 g/mol. Its IUPAC name is 6,7-dimethyl-4-[[(2R)-2-(morpholine-4-carbonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]methyl]chromen-2-one.
| Compound Name | 6,7-dimethyl-4-[[(2R)-2-(morpholine-4-carbonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 26388023 |
| Molecular Formula | C25H26N2O5 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 6,7-dimethyl-4-[[(2R)-2-(morpholine-4-carbonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]methyl]chromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CN3C[C@H](C(=O)N4CCOCC4)Oc4ccccc43)c2cc1C |
| InChI | InChI=1S/C25H26N2O5/c1-16-11-19-18(13-24(28)32-22(19)12-17(16)2)14-27-15-23(25(29)26-7-9-30-10-8-26)31-21-6-4-3-5-20(21)27/h3-6,11-13,23H,7-10,14-15H2,1-2H3/t23-/m1/s1 |
| InChIKey | JQEQAULKUOQEGS-HSZRJFAPSA-N |
| XLogP | 3.04 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|