C18H19NO6S — CID 2640418
[2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] furan-2-carboxylate (PubChem CID 2640418) has the molecular formula C18H19NO6S and a molecular weight of 377.42 g/mol. Its IUPAC name is [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] furan-2-carboxylate.
| Compound Name | [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 2640418 |
| Molecular Formula | C18H19NO6S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] furan-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccco1)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C18H19NO6S/c20-16(13-25-18(21)17-5-4-12-24-17)14-6-8-15(9-7-14)26(22,23)19-10-2-1-3-11-19/h4-9,12H,1-3,10-11,13H2 |
| InChIKey | VBIHWVTXYQDKDJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |