C18H18BrNO6S — CID 2645512
[2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 5-bromofuran-2-carboxylate (PubChem CID 2645512) has the molecular formula C18H18BrNO6S and a molecular weight of 456.31 g/mol. Its IUPAC name is [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 5-bromofuran-2-carboxylate.
| Compound Name | [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 5-bromofuran-2-carboxylate |
|---|---|
| PubChem CID | 2645512 |
| Molecular Formula | C18H18BrNO6S |
| Molecular Weight | 456.31 g/mol |
| Exact Mass | 455.00 |
| IUPAC Name | [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 5-bromofuran-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc(Br)o1)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C18H18BrNO6S/c19-17-9-8-16(26-17)18(22)25-12-15(21)13-4-6-14(7-5-13)27(23,24)20-10-2-1-3-11-20/h4-9H,1-3,10-12H2 |
| InChIKey | HQLNTVCPRWWUDV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |