C14H26N6O2S — CID 26405634
2-[5-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]tetrazol-1-yl]-N-(3-methylsulfanylpropyl)acetamide (PubChem CID 26405634) has the molecular formula C14H26N6O2S and a molecular weight of 342.47 g/mol. Its IUPAC name is 2-[5-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]tetrazol-1-yl]-N-(3-methylsulfanylpropyl)acetamide.
| Compound Name | 2-[5-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]tetrazol-1-yl]-N-(3-methylsulfanylpropyl)acetamide |
|---|---|
| PubChem CID | 26405634 |
| Molecular Formula | C14H26N6O2S |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 2-[5-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]tetrazol-1-yl]-N-(3-methylsulfanylpropyl)acetamide |
| SMILES | CSCCCNC(=O)Cn1nnnc1CN1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C14H26N6O2S/c1-11-7-19(8-12(2)22-11)9-13-16-17-18-20(13)10-14(21)15-5-4-6-23-3/h11-12H,4-10H2,1-3H3,(H,15,21)/t11-,12+ |
| InChIKey | OODMCHLLHGJPGI-TXEJJXNPSA-N |
| XLogP | 0.15 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|