C16H28N6O3S — CID 45211270
methyl 2-[[2-[5-(azepan-1-ylmethyl)tetrazol-1-yl]acetyl]amino]-4-methylsulfanylbutanoate (PubChem CID 45211270) has the molecular formula C16H28N6O3S and a molecular weight of 384.51 g/mol. Its IUPAC name is methyl 2-[[2-[5-(azepan-1-ylmethyl)tetrazol-1-yl]acetyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl 2-[[2-[5-(azepan-1-ylmethyl)tetrazol-1-yl]acetyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 45211270 |
| Molecular Formula | C16H28N6O3S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | methyl 2-[[2-[5-(azepan-1-ylmethyl)tetrazol-1-yl]acetyl]amino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)C(CCSC)NC(=O)Cn1nnnc1CN1CCCCCC1 |
| InChI | InChI=1S/C16H28N6O3S/c1-25-16(24)13(7-10-26-2)17-15(23)12-22-14(18-19-20-22)11-21-8-5-3-4-6-9-21/h13H,3-12H2,1-2H3,(H,17,23) |
| InChIKey | FSWDIEJINVDIOB-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |