C18H30N6O — CID 72855711
2-[5-(azepan-1-ylmethyl)tetrazol-1-yl]-N-[1-(cyclohexen-1-yl)ethyl]acetamide (PubChem CID 72855711) has the molecular formula C18H30N6O and a molecular weight of 346.48 g/mol. Its IUPAC name is 2-[5-(azepan-1-ylmethyl)tetrazol-1-yl]-N-[1-(cyclohexen-1-yl)ethyl]acetamide.
| Compound Name | 2-[5-(azepan-1-ylmethyl)tetrazol-1-yl]-N-[1-(cyclohexen-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 72855711 |
| Molecular Formula | C18H30N6O |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 2-[5-(azepan-1-ylmethyl)tetrazol-1-yl]-N-[1-(cyclohexen-1-yl)ethyl]acetamide |
| SMILES | CC(NC(=O)Cn1nnnc1CN1CCCCCC1)C1=CCCCC1 |
| InChI | InChI=1S/C18H30N6O/c1-15(16-9-5-4-6-10-16)19-18(25)14-24-17(20-21-22-24)13-23-11-7-2-3-8-12-23/h9,15H,2-8,10-14H2,1H3,(H,19,25) |
| InChIKey | NJDJYQILWOLWNN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|