C15H28N6O2 — CID 45200711
N-(1-methoxybutan-2-yl)-2-[5-[(4-methylpiperidin-1-yl)methyl]tetrazol-1-yl]acetamide (PubChem CID 45200711) has the molecular formula C15H28N6O2 and a molecular weight of 324.43 g/mol. Its IUPAC name is N-(1-methoxybutan-2-yl)-2-[5-[(4-methylpiperidin-1-yl)methyl]tetrazol-1-yl]acetamide.
| Compound Name | N-(1-methoxybutan-2-yl)-2-[5-[(4-methylpiperidin-1-yl)methyl]tetrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 45200711 |
| Molecular Formula | C15H28N6O2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | N-(1-methoxybutan-2-yl)-2-[5-[(4-methylpiperidin-1-yl)methyl]tetrazol-1-yl]acetamide |
| SMILES | CCC(COC)NC(=O)Cn1nnnc1CN1CCC(C)CC1 |
| InChI | InChI=1S/C15H28N6O2/c1-4-13(11-23-3)16-15(22)10-21-14(17-18-19-21)9-20-7-5-12(2)6-8-20/h12-13H,4-11H2,1-3H3,(H,16,22) |
| InChIKey | BXURZKVASIIHNH-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |