C18H15ClN4O3 — CID 26414832
(8S)-5-acetyl-8-(4-chlorophenyl)-6,12-dimethyl-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,6,12-tetraen-10-one (PubChem CID 26414832) has the molecular formula C18H15ClN4O3 and a molecular weight of 370.80 g/mol. Its IUPAC name is (8S)-5-acetyl-8-(4-chlorophenyl)-6,12-dimethyl-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,6,12-tetraen-10-one.
| Compound Name | (8S)-5-acetyl-8-(4-chlorophenyl)-6,12-dimethyl-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,6,12-tetraen-10-one |
|---|---|
| PubChem CID | 26414832 |
| Molecular Formula | C18H15ClN4O3 |
| Molecular Weight | 370.80 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | (8S)-5-acetyl-8-(4-chlorophenyl)-6,12-dimethyl-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,6,12-tetraen-10-one |
| SMILES | CC(=O)n1nc2c(c1C)[C@H](c1ccc(Cl)cc1)c1c(nc(C)[nH]c1=O)O2 |
| InChI | InChI=1S/C18H15ClN4O3/c1-8-13-14(11-4-6-12(19)7-5-11)15-16(25)20-9(2)21-17(15)26-18(13)22-23(8)10(3)24/h4-7,14H,1-3H3,(H,20,21,25)/t14-/m0/s1 |
| InChIKey | YMCRHIBFCFVONZ-AWEZNQCLSA-N |
| XLogP | 3.18 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.80 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |