C24H21N3O5S — CID 2647341
(5-phenyl-1,3,4-oxadiazol-2-yl)methyl 4-[ethyl(phenyl)sulfamoyl]benzoate (PubChem CID 2647341) has the molecular formula C24H21N3O5S and a molecular weight of 463.52 g/mol. Its IUPAC name is (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 4-[ethyl(phenyl)sulfamoyl]benzoate.
| Compound Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 4-[ethyl(phenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2647341 |
| Molecular Formula | C24H21N3O5S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 4-[ethyl(phenyl)sulfamoyl]benzoate |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(C(=O)OCc2nnc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C24H21N3O5S/c1-2-27(20-11-7-4-8-12-20)33(29,30)21-15-13-19(14-16-21)24(28)31-17-22-25-26-23(32-22)18-9-5-3-6-10-18/h3-16H,2,17H2,1H3 |
| InChIKey | JHYFENWEKBUVGS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 102.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |