C22H21NO7S — CID 2587918
methyl 5-[[4-[ethyl(phenyl)sulfamoyl]benzoyl]oxymethyl]furan-2-carboxylate (PubChem CID 2587918) has the molecular formula C22H21NO7S and a molecular weight of 443.48 g/mol. Its IUPAC name is methyl 5-[[4-[ethyl(phenyl)sulfamoyl]benzoyl]oxymethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[4-[ethyl(phenyl)sulfamoyl]benzoyl]oxymethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 2587918 |
| Molecular Formula | C22H21NO7S |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | methyl 5-[[4-[ethyl(phenyl)sulfamoyl]benzoyl]oxymethyl]furan-2-carboxylate |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(C(=O)OCc2ccc(C(=O)OC)o2)cc1 |
| InChI | InChI=1S/C22H21NO7S/c1-3-23(17-7-5-4-6-8-17)31(26,27)19-12-9-16(10-13-19)21(24)29-15-18-11-14-20(30-18)22(25)28-2/h4-14H,3,15H2,1-2H3 |
| InChIKey | IPQBTZLZDAYIDD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |