C21H18ClNO7S — CID 2577257
methyl 5-[[2-chloro-5-[methyl(phenyl)sulfamoyl]benzoyl]oxymethyl]furan-2-carboxylate (PubChem CID 2577257) has the molecular formula C21H18ClNO7S and a molecular weight of 463.90 g/mol. Its IUPAC name is methyl 5-[[2-chloro-5-[methyl(phenyl)sulfamoyl]benzoyl]oxymethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[2-chloro-5-[methyl(phenyl)sulfamoyl]benzoyl]oxymethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 2577257 |
| Molecular Formula | C21H18ClNO7S |
| Molecular Weight | 463.90 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | methyl 5-[[2-chloro-5-[methyl(phenyl)sulfamoyl]benzoyl]oxymethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(COC(=O)c2cc(S(=O)(=O)N(C)c3ccccc3)ccc2Cl)o1 |
| InChI | InChI=1S/C21H18ClNO7S/c1-23(14-6-4-3-5-7-14)31(26,27)16-9-10-18(22)17(12-16)20(24)29-13-15-8-11-19(30-15)21(25)28-2/h3-12H,13H2,1-2H3 |
| InChIKey | RVMUTMCDMVBLIG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.90 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |