C25H26N2O7 — CID 26497257
(4Z)-2-(4-ethoxyphenyl)-4-[[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 26497257) has the molecular formula C25H26N2O7 and a molecular weight of 466.49 g/mol. Its IUPAC name is (4Z)-2-(4-ethoxyphenyl)-4-[[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(4-ethoxyphenyl)-4-[[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 26497257 |
| Molecular Formula | C25H26N2O7 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | (4Z)-2-(4-ethoxyphenyl)-4-[[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | CCOc1ccc(C2=N/C(=C\c3ccc(OCC(=O)N4CCOCC4)c(OC)c3)C(=O)O2)cc1 |
| InChI | InChI=1S/C25H26N2O7/c1-3-32-19-7-5-18(6-8-19)24-26-20(25(29)34-24)14-17-4-9-21(22(15-17)30-2)33-16-23(28)27-10-12-31-13-11-27/h4-9,14-15H,3,10-13,16H2,1-2H3/b20-14- |
| InChIKey | MTUNNLVMYCLBTF-ZHZULCJRSA-N |
| XLogP | 2.68 |
| TPSA | 95.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|