C15H19ClN3O+ — CID 2655081
N-(3-chloro-4-cyanophenyl)-2-(4-methylpiperidin-1-ium-1-yl)acetamide (PubChem CID 2655081) has the molecular formula C15H19ClN3O+ and a molecular weight of 292.79 g/mol. Its IUPAC name is N-(3-chloro-4-cyanophenyl)-2-(4-methylpiperidin-1-ium-1-yl)acetamide.
| Compound Name | N-(3-chloro-4-cyanophenyl)-2-(4-methylpiperidin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 2655081 |
| Molecular Formula | C15H19ClN3O+ |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | N-(3-chloro-4-cyanophenyl)-2-(4-methylpiperidin-1-ium-1-yl)acetamide |
| SMILES | CC1CC[NH+](CC(=O)Nc2ccc(C#N)c(Cl)c2)CC1 |
| InChI | InChI=1S/C15H18ClN3O/c1-11-4-6-19(7-5-11)10-15(20)18-13-3-2-12(9-17)14(16)8-13/h2-3,8,11H,4-7,10H2,1H3,(H,18,20)/p+1 |
| InChIKey | GFPNRGBURNHBNS-UHFFFAOYSA-O |
| XLogP | 1.46 |
| TPSA | 57.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |